C14H17ClN4 — CID 54990454
3-[(7-chloroquinolin-4-yl)-methylamino]-2-methylpropanimidamide (PubChem CID 54990454) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 3-[(7-chloroquinolin-4-yl)-methylamino]-2-methylpropanimidamide.
| Compound Name | 3-[(7-chloroquinolin-4-yl)-methylamino]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 54990454 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[(7-chloroquinolin-4-yl)-methylamino]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN(C)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H17ClN4/c1-9(14(16)17)8-19(2)13-5-6-18-12-7-10(15)3-4-11(12)13/h3-7,9H,8H2,1-2H3,(H3,16,17) |
| InChIKey | JFBHXKPVYNVTQP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|