About (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid
(2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid (PubChem CID 54990723) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid |
| PubChem CID | 54990723 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C11H15N3O5/c1-5-7(9(16)14-11(19)13-5)3-4-8(15)12-6(2)10(17)18/h6H,3-4H2,1-2H3,(H,12,15)(H,17,18)(H2,13,14,16,19)/t6-/m1/s1 |
| InChIKey | CFPQAUVMJLERKQ-ZCFIWIBFSA-N |
| XLogP | -1.11 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid?
The IUPAC name of (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid (CID 54990723) is (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid.
What is the SMILES notation for (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid?
The canonical SMILES for (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid is Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)N[C@H](C)C(=O)O.
What is the InChIKey of (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid?
The InChIKey is CFPQAUVMJLERKQ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H15N3O5/c1-5-7(9(16)14-11(19)13-5)3-4-8(15)12-6(2)10(17)18/h6H,3-4H2,1-2H3,(H,12,15)(H,17,18)(H2,13,14,16,19)/t6-/m1/s1.
What are the key properties of (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid?
(2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid has a molecular weight of 269.26 g/mol, XLogP of -1.11, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]propanoic acid is sourced from PubChem (CID 54990723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).