C11H19F3N2O2 — CID 54991195
(2R)-2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide (PubChem CID 54991195) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide.
| Compound Name | (2R)-2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 54991195 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2R)-2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide |
| SMILES | C[C@@H](N)C(=O)NC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-7(15)10(17)16-8-3-2-4-9(5-8)18-6-11(12,13)14/h7-9H,2-6,15H2,1H3,(H,16,17)/t7-,8?,9?/m1/s1 |
| InChIKey | MHHZXLAQBXHWSU-AFPNSQJFSA-N |
| XLogP | 1.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |