About N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide
N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide (PubChem CID 54992415) has the molecular formula C14H29N3O2
and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide.
Molecular Properties
| Compound Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide |
| PubChem CID | 54992415 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide |
| SMILES | CCN(CC/C(N)=N/O)C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C14H29N3O2/c1-6-17(8-7-12(15)16-19)13(18)9-11(2)10-14(3,4)5/h11,19H,6-10H2,1-5H3,(H2,15,16) |
| InChIKey | DQHXFNPVNZUGHT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide?
The IUPAC name of N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide (CID 54992415) is N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide.
What is the SMILES notation for N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide?
The canonical SMILES for N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide is CCN(CC/C(N)=N/O)C(=O)CC(C)CC(C)(C)C.
What is the InChIKey of N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide?
The InChIKey is DQHXFNPVNZUGHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O2/c1-6-17(8-7-12(15)16-19)13(18)9-11(2)10-14(3,4)5/h11,19H,6-10H2,1-5H3,(H2,15,16).
What are the key properties of N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide?
N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide has a molecular weight of 271.40 g/mol, XLogP of 2.43, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-3,5,5-trimethylhexanamide is sourced from PubChem (CID 54992415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).