C9H18F3N3O2 — CID 54992458
3-[ethyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-N'-hydroxypropanimidamide (PubChem CID 54992458) has the molecular formula C9H18F3N3O2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 3-[ethyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[ethyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 54992458 |
| Molecular Formula | C9H18F3N3O2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-[ethyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CCOCC(F)(F)F)CC/C(N)=N/O |
| InChI | InChI=1S/C9H18F3N3O2/c1-2-15(4-3-8(13)14-16)5-6-17-7-9(10,11)12/h16H,2-7H2,1H3,(H2,13,14) |
| InChIKey | DRQGGZHQBAEUNZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|