About N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide
N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 54993492) has the molecular formula C11H18N2O4S
and a molecular weight of 274.34 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| PubChem CID | 54993492 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | COCC(O)CN(C)C(=O)Cn1c(C)csc1=O |
| InChI | InChI=1S/C11H18N2O4S/c1-8-7-18-11(16)13(8)5-10(15)12(2)4-9(14)6-17-3/h7,9,14H,4-6H2,1-3H3 |
| InChIKey | VBGGXOGFPIAKOE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The IUPAC name of N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (CID 54993492) is N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
What is the SMILES notation for N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The canonical SMILES for N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide is COCC(O)CN(C)C(=O)Cn1c(C)csc1=O.
What is the InChIKey of N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The InChIKey is VBGGXOGFPIAKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-8-7-18-11(16)13(8)5-10(15)12(2)4-9(14)6-17-3/h7,9,14H,4-6H2,1-3H3.
What are the key properties of N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide has a molecular weight of 274.34 g/mol, XLogP of -0.32, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide is sourced from PubChem (CID 54993492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).