C13H20N2O4 — CID 54993634
N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-oxo-1-pyridinyl)propanamide (PubChem CID 54993634) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 54993634 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-oxo-1-pyridinyl)propanamide |
| SMILES | COCC(O)CN(C)C(=O)CCn1ccccc1=O |
| InChI | InChI=1S/C13H20N2O4/c1-14(9-11(16)10-19-2)12(17)6-8-15-7-4-3-5-13(15)18/h3-5,7,11,16H,6,8-10H2,1-2H3 |
| InChIKey | OLVSKAMJEBPQHT-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |