C15H23NO2 — CID 54994680
2-[N-cyclohexyl-2-(hydroxymethyl)anilino]ethanol (PubChem CID 54994680) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[N-cyclohexyl-2-(hydroxymethyl)anilino]ethanol.
| Compound Name | 2-[N-cyclohexyl-2-(hydroxymethyl)anilino]ethanol |
|---|---|
| PubChem CID | 54994680 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-[N-cyclohexyl-2-(hydroxymethyl)anilino]ethanol |
| SMILES | OCCN(c1ccccc1CO)C1CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c17-11-10-16(14-7-2-1-3-8-14)15-9-5-4-6-13(15)12-18/h4-6,9,14,17-18H,1-3,7-8,10-12H2 |
| InChIKey | YRKORKRKWBGFFH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |