C13H19BrN2O — CID 54994722
2-[5-bromo-N-cyclopropyl-2-(methylaminomethyl)anilino]ethanol (PubChem CID 54994722) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 2-[5-bromo-N-cyclopropyl-2-(methylaminomethyl)anilino]ethanol.
| Compound Name | 2-[5-bromo-N-cyclopropyl-2-(methylaminomethyl)anilino]ethanol |
|---|---|
| PubChem CID | 54994722 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[5-bromo-N-cyclopropyl-2-(methylaminomethyl)anilino]ethanol |
| SMILES | CNCc1ccc(Br)cc1N(CCO)C1CC1 |
| InChI | InChI=1S/C13H19BrN2O/c1-15-9-10-2-3-11(14)8-13(10)16(6-7-17)12-4-5-12/h2-3,8,12,15,17H,4-7,9H2,1H3 |
| InChIKey | TZRNBSAYAIOVCF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |