C12H17N3O2 — CID 54994907
2-[cyclopropyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 54994907) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-[cyclopropyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[cyclopropyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 54994907 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-[cyclopropyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccccc1N(CCO)C1CC1 |
| InChI | InChI=1S/C12H17N3O2/c13-12(14-17)10-3-1-2-4-11(10)15(7-8-16)9-5-6-9/h1-4,9,16-17H,5-8H2,(H2,13,14) |
| InChIKey | ZMTJUBSDGDAOMF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|