About 1-ethyl-1,3-dimethylcyclohexane
1-ethyl-1,3-dimethylcyclohexane (PubChem CID 549959) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is 1-ethyl-1,3-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-ethyl-1,3-dimethylcyclohexane |
| PubChem CID | 549959 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | 1-ethyl-1,3-dimethylcyclohexane |
| SMILES | CCC1(C)CCCC(C)C1 |
| InChI | InChI=1S/C10H20/c1-4-10(3)7-5-6-9(2)8-10/h9H,4-8H2,1-3H3 |
| InChIKey | YLZKVXHQMPWDBJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-1,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,3-dimethylcyclohexane?
The IUPAC name of 1-ethyl-1,3-dimethylcyclohexane (CID 549959) is 1-ethyl-1,3-dimethylcyclohexane.
What is the SMILES notation for 1-ethyl-1,3-dimethylcyclohexane?
The canonical SMILES for 1-ethyl-1,3-dimethylcyclohexane is CCC1(C)CCCC(C)C1.
What is the InChIKey of 1-ethyl-1,3-dimethylcyclohexane?
The InChIKey is YLZKVXHQMPWDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20/c1-4-10(3)7-5-6-9(2)8-10/h9H,4-8H2,1-3H3.
What are the key properties of 1-ethyl-1,3-dimethylcyclohexane?
1-ethyl-1,3-dimethylcyclohexane has a molecular weight of 140.27 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,3-dimethylcyclohexane is sourced from PubChem (CID 549959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).