C13H20N2O2 — CID 54995976
2-[(5-amino-2-methoxyphenyl)methyl-cyclopropylamino]ethanol (PubChem CID 54995976) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[(5-amino-2-methoxyphenyl)methyl-cyclopropylamino]ethanol.
| Compound Name | 2-[(5-amino-2-methoxyphenyl)methyl-cyclopropylamino]ethanol |
|---|---|
| PubChem CID | 54995976 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-[(5-amino-2-methoxyphenyl)methyl-cyclopropylamino]ethanol |
| SMILES | COc1ccc(N)cc1CN(CCO)C1CC1 |
| InChI | InChI=1S/C13H20N2O2/c1-17-13-5-2-11(14)8-10(13)9-15(6-7-16)12-3-4-12/h2,5,8,12,16H,3-4,6-7,9,14H2,1H3 |
| InChIKey | DSJDNOAQWVLCRB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|