C13H16ClFN2 — CID 54996547
3-[(2-chloro-4-fluorophenyl)methyl-propan-2-ylamino]propanenitrile (PubChem CID 54996547) has the molecular formula C13H16ClFN2 and a molecular weight of 254.74 g/mol. Its IUPAC name is 3-[(2-chloro-4-fluorophenyl)methyl-propan-2-ylamino]propanenitrile.
| Compound Name | 3-[(2-chloro-4-fluorophenyl)methyl-propan-2-ylamino]propanenitrile |
|---|---|
| PubChem CID | 54996547 |
| Molecular Formula | C13H16ClFN2 |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3-[(2-chloro-4-fluorophenyl)methyl-propan-2-ylamino]propanenitrile |
| SMILES | CC(C)N(CCC#N)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H16ClFN2/c1-10(2)17(7-3-6-16)9-11-4-5-12(15)8-13(11)14/h4-5,8,10H,3,7,9H2,1-2H3 |
| InChIKey | GYOWCHCCVAHQBK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |