C13H21N5O — CID 54996820
4-[(3-amino-3-iminopropyl)-propan-2-ylamino]-N-methylpyridine-2-carboxamide (PubChem CID 54996820) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[(3-amino-3-iminopropyl)-propan-2-ylamino]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[(3-amino-3-iminopropyl)-propan-2-ylamino]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 54996820 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-[(3-amino-3-iminopropyl)-propan-2-ylamino]-N-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\N)CCN(c1ccnc(C(=O)NC)c1)C(C)C |
| InChI | InChI=1S/C13H21N5O/c1-9(2)18(7-5-12(14)15)10-4-6-17-11(8-10)13(19)16-3/h4,6,8-9H,5,7H2,1-3H3,(H3,14,15)(H,16,19) |
| InChIKey | QDUJRTNJHCQOFY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|