About 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide
3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide (PubChem CID 54997728) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide |
| PubChem CID | 54997728 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide |
| SMILES | Cc1nccn1CCN(CC/C(N)=N/O)C1CC1 |
| InChI | InChI=1S/C12H21N5O/c1-10-14-5-7-16(10)8-9-17(11-2-3-11)6-4-12(13)15-18/h5,7,11,18H,2-4,6,8-9H2,1H3,(H2,13,15) |
| InChIKey | RYACIEVHFDNGBI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide?
The IUPAC name of 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide (CID 54997728) is 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide?
The canonical SMILES for 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide is Cc1nccn1CCN(CC/C(N)=N/O)C1CC1.
What is the InChIKey of 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide?
The InChIKey is RYACIEVHFDNGBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-10-14-5-7-16(10)8-9-17(11-2-3-11)6-4-12(13)15-18/h5,7,11,18H,2-4,6,8-9H2,1H3,(H2,13,15).
What are the key properties of 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide?
3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide has a molecular weight of 251.33 g/mol, XLogP of 0.79, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl-[2-(2-methylimidazol-1-yl)ethyl]amino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 54997728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).