C13H26N2O4 — CID 54998790
(2S)-2-[[3-hydroxypropyl(propan-2-yl)carbamoyl]amino]-3-methylpentanoic acid (PubChem CID 54998790) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2S)-2-[[3-hydroxypropyl(propan-2-yl)carbamoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[[3-hydroxypropyl(propan-2-yl)carbamoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 54998790 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (2S)-2-[[3-hydroxypropyl(propan-2-yl)carbamoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)N(CCCO)C(C)C)C(=O)O |
| InChI | InChI=1S/C13H26N2O4/c1-5-10(4)11(12(17)18)14-13(19)15(9(2)3)7-6-8-16/h9-11,16H,5-8H2,1-4H3,(H,14,19)(H,17,18)/t10?,11-/m0/s1 |
| InChIKey | RYHIUEFYBPZAEO-DTIOYNMSSA-N |
| XLogP | 1.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |