C10H22B2O2 — CID 549995
2,3,5,6-tetraethyl-1,4,2,5-dioxadiborinane (PubChem CID 549995) has the molecular formula C10H22B2O2 and a molecular weight of 195.91 g/mol. Its IUPAC name is 2,3,5,6-tetraethyl-1,4,2,5-dioxadiborinane.
| Compound Name | 2,3,5,6-tetraethyl-1,4,2,5-dioxadiborinane |
|---|---|
| PubChem CID | 549995 |
| Molecular Formula | C10H22B2O2 |
| Molecular Weight | 195.91 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 2,3,5,6-tetraethyl-1,4,2,5-dioxadiborinane |
| SMILES | CCB1OC(CC)B(CC)OC1CC |
| InChI | InChI=1S/C10H22B2O2/c1-5-9-11(7-3)14-10(6-2)12(8-4)13-9/h9-10H,5-8H2,1-4H3 |
| InChIKey | DXWXODBQZQSAPL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.91 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|