About 4,8-dimethylnonan-1-ol
4,8-dimethylnonan-1-ol (PubChem CID 549996) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 4,8-dimethylnonan-1-ol.
Molecular Properties
| Compound Name | 4,8-dimethylnonan-1-ol |
| PubChem CID | 549996 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 4,8-dimethylnonan-1-ol |
| SMILES | CC(C)CCCC(C)CCCO |
| InChI | InChI=1S/C11H24O/c1-10(2)6-4-7-11(3)8-5-9-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | ASDSWUHLJCTXPE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,8-dimethylnonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylnonan-1-ol?
The IUPAC name of 4,8-dimethylnonan-1-ol (CID 549996) is 4,8-dimethylnonan-1-ol.
What is the SMILES notation for 4,8-dimethylnonan-1-ol?
The canonical SMILES for 4,8-dimethylnonan-1-ol is CC(C)CCCC(C)CCCO.
What is the InChIKey of 4,8-dimethylnonan-1-ol?
The InChIKey is ASDSWUHLJCTXPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O/c1-10(2)6-4-7-11(3)8-5-9-12/h10-12H,4-9H2,1-3H3.
What are the key properties of 4,8-dimethylnonan-1-ol?
4,8-dimethylnonan-1-ol has a molecular weight of 172.31 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylnonan-1-ol is sourced from PubChem (CID 549996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).