About 4,6-dimethyltrithiane
4,6-dimethyltrithiane (PubChem CID 550009) has the molecular formula C5H10S3
and a molecular weight of 166.34 g/mol. Its IUPAC name is 4,6-dimethyltrithiane.
Molecular Properties
| Compound Name | 4,6-dimethyltrithiane |
| PubChem CID | 550009 |
| Molecular Formula | C5H10S3 |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 165.99 |
| IUPAC Name | 4,6-dimethyltrithiane |
| SMILES | CC1CC(C)SSS1 |
| InChI | InChI=1S/C5H10S3/c1-4-3-5(2)7-8-6-4/h4-5H,3H2,1-2H3 |
| InChIKey | JJKQDZKSTXTCRP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyltrithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyltrithiane?
The IUPAC name of 4,6-dimethyltrithiane (CID 550009) is 4,6-dimethyltrithiane.
What is the SMILES notation for 4,6-dimethyltrithiane?
The canonical SMILES for 4,6-dimethyltrithiane is CC1CC(C)SSS1.
What is the InChIKey of 4,6-dimethyltrithiane?
The InChIKey is JJKQDZKSTXTCRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10S3/c1-4-3-5(2)7-8-6-4/h4-5H,3H2,1-2H3.
What are the key properties of 4,6-dimethyltrithiane?
4,6-dimethyltrithiane has a molecular weight of 166.34 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyltrithiane is sourced from PubChem (CID 550009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).