About N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine
N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine (PubChem CID 55000970) has the molecular formula C12H29N3O2S
and a molecular weight of 279.45 g/mol. Its IUPAC name is N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine |
| PubChem CID | 55000970 |
| Molecular Formula | C12H29N3O2S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine |
| SMILES | CCCCCN(C(C)C)S(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C12H29N3O2S/c1-5-6-7-11-15(12(2)3)18(16,17)14(4)10-8-9-13/h12H,5-11,13H2,1-4H3 |
| InChIKey | BZAHATCWCJKCJZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine (CID 55000970) is N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine is CCCCCN(C(C)C)S(=O)(=O)N(C)CCCN.
What is the InChIKey of N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine?
The InChIKey is BZAHATCWCJKCJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29N3O2S/c1-5-6-7-11-15(12(2)3)18(16,17)14(4)10-8-9-13/h12H,5-11,13H2,1-4H3.
What are the key properties of N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine?
N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine has a molecular weight of 279.45 g/mol, XLogP of 1.41, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[pentyl(propan-2-yl)sulfamoyl]propane-1,3-diamine is sourced from PubChem (CID 55000970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).