C16H28N2 — CID 55001809
N-[[2-(aminomethyl)phenyl]methyl]-N-propan-2-ylpentan-1-amine (PubChem CID 55001809) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-N-propan-2-ylpentan-1-amine.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 55001809 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-N-propan-2-ylpentan-1-amine |
| SMILES | CCCCCN(Cc1ccccc1CN)C(C)C |
| InChI | InChI=1S/C16H28N2/c1-4-5-8-11-18(14(2)3)13-16-10-7-6-9-15(16)12-17/h6-7,9-10,14H,4-5,8,11-13,17H2,1-3H3 |
| InChIKey | DBXCESSBOGMFFZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|