C16H22FNO — CID 55002178
1-[cyclopropyl(2-methylpropyl)amino]-3-(2-fluorophenyl)propan-2-one (PubChem CID 55002178) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-[cyclopropyl(2-methylpropyl)amino]-3-(2-fluorophenyl)propan-2-one.
| Compound Name | 1-[cyclopropyl(2-methylpropyl)amino]-3-(2-fluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 55002178 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[cyclopropyl(2-methylpropyl)amino]-3-(2-fluorophenyl)propan-2-one |
| SMILES | CC(C)CN(CC(=O)Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C16H22FNO/c1-12(2)10-18(14-7-8-14)11-15(19)9-13-5-3-4-6-16(13)17/h3-6,12,14H,7-11H2,1-2H3 |
| InChIKey | JTXWWWZFWGKRIG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |