C13H27N3O — CID 55002703
2-[[2-(aminomethyl)cyclohexyl]-butylamino]acetamide (PubChem CID 55002703) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)cyclohexyl]-butylamino]acetamide.
| Compound Name | 2-[[2-(aminomethyl)cyclohexyl]-butylamino]acetamide |
|---|---|
| PubChem CID | 55002703 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 2-[[2-(aminomethyl)cyclohexyl]-butylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)C1CCCCC1CN |
| InChI | InChI=1S/C13H27N3O/c1-2-3-8-16(10-13(15)17)12-7-5-4-6-11(12)9-14/h11-12H,2-10,14H2,1H3,(H2,15,17) |
| InChIKey | XFNXQFGQAAAPQA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |