About ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate
ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 55005655) has the molecular formula C11H17N5O3
and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate |
| PubChem CID | 55005655 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1C(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C11H17N5O3/c1-2-19-10(18)8-4-3-5-16(8)9(17)6-15-7-13-11(12)14-15/h7-8H,2-6H2,1H3,(H2,12,14) |
| InChIKey | GPBNVQCHDXLTLG-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
The IUPAC name of ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate (CID 55005655) is ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
The canonical SMILES for ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate is CCOC(=O)C1CCCN1C(=O)Cn1cnc(N)n1.
What is the InChIKey of ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
The InChIKey is GPBNVQCHDXLTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O3/c1-2-19-10(18)8-4-3-5-16(8)9(17)6-15-7-13-11(12)14-15/h7-8H,2-6H2,1H3,(H2,12,14).
What are the key properties of ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate has a molecular weight of 267.29 g/mol, XLogP of -0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-(3-amino-1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 55005655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).