C13H17FN2O3 — CID 55006210
methyl 2-[(3-fluorophenyl)carbamoyl-propylamino]acetate (PubChem CID 55006210) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl 2-[(3-fluorophenyl)carbamoyl-propylamino]acetate.
| Compound Name | methyl 2-[(3-fluorophenyl)carbamoyl-propylamino]acetate |
|---|---|
| PubChem CID | 55006210 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl 2-[(3-fluorophenyl)carbamoyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2O3/c1-3-7-16(9-12(17)19-2)13(18)15-11-6-4-5-10(14)8-11/h4-6,8H,3,7,9H2,1-2H3,(H,15,18) |
| InChIKey | MCHQCVCUDPJWIL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |