About methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate
methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate (PubChem CID 55006851) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate |
| PubChem CID | 55006851 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(c1nnc(C)c(C)c1C#N)C(C)C |
| InChI | InChI=1S/C13H18N4O2/c1-8(2)17(7-12(18)19-5)13-11(6-14)9(3)10(4)15-16-13/h8H,7H2,1-5H3 |
| InChIKey | YMVBUCFYKCIUQA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate?
The IUPAC name of methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate (CID 55006851) is methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate.
What is the SMILES notation for methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate?
The canonical SMILES for methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate is COC(=O)CN(c1nnc(C)c(C)c1C#N)C(C)C.
What is the InChIKey of methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate?
The InChIKey is YMVBUCFYKCIUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c1-8(2)17(7-12(18)19-5)13-11(6-14)9(3)10(4)15-16-13/h8H,7H2,1-5H3.
What are the key properties of methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate?
methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate has a molecular weight of 262.31 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-propan-2-ylamino]acetate is sourced from PubChem (CID 55006851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).