About N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide
N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 55007028) has the molecular formula C9H16F3N3O2
and a molecular weight of 255.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide |
| PubChem CID | 55007028 |
| Molecular Formula | C9H16F3N3O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)C(=O)NCCN |
| InChI | InChI=1S/C9H16F3N3O2/c1-2-5-15(6-9(10,11)12)8(17)7(16)14-4-3-13/h2-6,13H2,1H3,(H,14,16) |
| InChIKey | MIIFEBXRXIFWIF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide?
The IUPAC name of N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide (CID 55007028) is N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide is CCCN(CC(F)(F)F)C(=O)C(=O)NCCN.
What is the InChIKey of N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide?
The InChIKey is MIIFEBXRXIFWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N3O2/c1-2-5-15(6-9(10,11)12)8(17)7(16)14-4-3-13/h2-6,13H2,1H3,(H,14,16).
What are the key properties of N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide?
N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide has a molecular weight of 255.24 g/mol, XLogP of -0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)oxamide is sourced from PubChem (CID 55007028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).