C12H17NO4 — CID 55008207
methyl 2-methyl-3-[methyl-(3-methylfuran-2-carbonyl)amino]propanoate (PubChem CID 55008207) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl 2-methyl-3-[methyl-(3-methylfuran-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-methyl-3-[methyl-(3-methylfuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 55008207 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | methyl 2-methyl-3-[methyl-(3-methylfuran-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(C)CN(C)C(=O)c1occc1C |
| InChI | InChI=1S/C12H17NO4/c1-8-5-6-17-10(8)11(14)13(3)7-9(2)12(15)16-4/h5-6,9H,7H2,1-4H3 |
| InChIKey | NPBLOILTNVXQLD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |