About methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate
methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate (PubChem CID 55008247) has the molecular formula C11H18F3NO4
and a molecular weight of 285.26 g/mol. Its IUPAC name is methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate |
| PubChem CID | 55008247 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate |
| SMILES | COC(=O)C(C)CN(C)C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO4/c1-8(10(17)18-3)6-15(2)9(16)4-5-19-7-11(12,13)14/h8H,4-7H2,1-3H3 |
| InChIKey | ILZOTNLXHATIKV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate?
The IUPAC name of methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate (CID 55008247) is methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate.
What is the SMILES notation for methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate?
The canonical SMILES for methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate is COC(=O)C(C)CN(C)C(=O)CCOCC(F)(F)F.
What is the InChIKey of methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate?
The InChIKey is ILZOTNLXHATIKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO4/c1-8(10(17)18-3)6-15(2)9(16)4-5-19-7-11(12,13)14/h8H,4-7H2,1-3H3.
What are the key properties of methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate?
methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate has a molecular weight of 285.26 g/mol, XLogP of 1.22, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]propanoate is sourced from PubChem (CID 55008247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).