C10H18F3N3O — CID 55008632
N-ethyl-2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 55008632) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is N-ethyl-2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-ethyl-2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 55008632 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-ethyl-2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN(CC(F)(F)F)C(=O)CN1CCNCC1 |
| InChI | InChI=1S/C10H18F3N3O/c1-2-16(8-10(11,12)13)9(17)7-15-5-3-14-4-6-15/h14H,2-8H2,1H3 |
| InChIKey | JLYOWYBDUWEWEF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |