C9H16F3NO3S — CID 55008781
1,1-dioxo-4-[propyl(2,2,2-trifluoroethyl)amino]thiolan-3-ol (PubChem CID 55008781) has the molecular formula C9H16F3NO3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 1,1-dioxo-4-[propyl(2,2,2-trifluoroethyl)amino]thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-[propyl(2,2,2-trifluoroethyl)amino]thiolan-3-ol |
|---|---|
| PubChem CID | 55008781 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1,1-dioxo-4-[propyl(2,2,2-trifluoroethyl)amino]thiolan-3-ol |
| SMILES | CCCN(CC(F)(F)F)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C9H16F3NO3S/c1-2-3-13(6-9(10,11)12)7-4-17(15,16)5-8(7)14/h7-8,14H,2-6H2,1H3 |
| InChIKey | WKEVMPUNXPWNNE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |