C10H17F3N4S — CID 55008784
4-propan-2-yl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione (PubChem CID 55008784) has the molecular formula C10H17F3N4S and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-propan-2-yl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-propan-2-yl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 55008784 |
| Molecular Formula | C10H17F3N4S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-propan-2-yl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCCN(CC(F)(F)F)c1n[nH]c(=S)n1C(C)C |
| InChI | InChI=1S/C10H17F3N4S/c1-4-5-16(6-10(11,12)13)8-14-15-9(18)17(8)7(2)3/h7H,4-6H2,1-3H3,(H,15,18) |
| InChIKey | JITRZRYUUONFHR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|