C11H15F3N4S — CID 55008801
3-[ethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 55008801) has the molecular formula C11H15F3N4S and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 55008801 |
| Molecular Formula | C11H15F3N4S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | CCN(CC(F)(F)F)c1nnc(C)c(C)c1C(N)=S |
| InChI | InChI=1S/C11H15F3N4S/c1-4-18(5-11(12,13)14)10-8(9(15)19)6(2)7(3)16-17-10/h4-5H2,1-3H3,(H2,15,19) |
| InChIKey | YPQJJNOURSITNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|