C13H18ClF3N2 — CID 55009185
3-(chloromethyl)-4,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 55009185) has the molecular formula C13H18ClF3N2 and a molecular weight of 294.75 g/mol. Its IUPAC name is 3-(chloromethyl)-4,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 3-(chloromethyl)-4,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55009185 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-(chloromethyl)-4,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | Cc1cc(C)c(CCl)c(N(CC(F)(F)F)C(C)C)n1 |
| InChI | InChI=1S/C13H18ClF3N2/c1-8(2)19(7-13(15,16)17)12-11(6-14)9(3)5-10(4)18-12/h5,8H,6-7H2,1-4H3 |
| InChIKey | MCAKIKIMEDIMSM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|