C11H16ClF3N2S — CID 55009371
N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 55009371) has the molecular formula C11H16ClF3N2S and a molecular weight of 300.78 g/mol. Its IUPAC name is N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 55009371 |
| Molecular Formula | C11H16ClF3N2S |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | CC(C)N(CCc1nc(CCl)cs1)CC(F)(F)F |
| InChI | InChI=1S/C11H16ClF3N2S/c1-8(2)17(7-11(13,14)15)4-3-10-16-9(5-12)6-18-10/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | VGBZHWCABLAYFK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|