C12H12F3NO2S — CID 55009477
N-ethyl-5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 55009477) has the molecular formula C12H12F3NO2S and a molecular weight of 291.29 g/mol. Its IUPAC name is N-ethyl-5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
| Compound Name | N-ethyl-5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55009477 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-ethyl-5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1ccc(C#CCO)s1 |
| InChI | InChI=1S/C12H12F3NO2S/c1-2-16(8-12(13,14)15)11(18)10-6-5-9(19-10)4-3-7-17/h5-6,17H,2,7-8H2,1H3 |
| InChIKey | RGOAIHWAIZJZOI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|