About 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid
3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid (PubChem CID 55009761) has the molecular formula C9H15F3N2O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid |
| PubChem CID | 55009761 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C9H15F3N2O3/c1-6(2)14(5-9(10,11)12)8(17)13-4-3-7(15)16/h6H,3-5H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | PESCNOGAGFXXMI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid?
The IUPAC name of 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid (CID 55009761) is 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid.
What is the SMILES notation for 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid?
The canonical SMILES for 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid is CC(C)N(CC(F)(F)F)C(=O)NCCC(=O)O.
What is the InChIKey of 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid?
The InChIKey is PESCNOGAGFXXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c1-6(2)14(5-9(10,11)12)8(17)13-4-3-7(15)16/h6H,3-5H2,1-2H3,(H,13,17)(H,15,16).
What are the key properties of 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid?
3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid has a molecular weight of 256.22 g/mol, XLogP of 1.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]amino]propanoic acid is sourced from PubChem (CID 55009761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).