C14H28N2O3 — CID 55009895
2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]hexanoic acid (PubChem CID 55009895) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]hexanoic acid.
| Compound Name | 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 55009895 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)N(C)C(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H28N2O3/c1-7-8-9-11(12(17)18)15-13(19)16(6)10(2)14(3,4)5/h10-11H,7-9H2,1-6H3,(H,15,19)(H,17,18) |
| InChIKey | XPFLSMCYODXKIJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |