2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid

C9H15F3N2O3 — CID 55009948

IUPAC2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid
SMILESCCN(CC(=O)O)C(=O)N(CC)CC(F)(F)F
InChIInChI=1S/C9H15F3N2O3/c1-3-13(5-7(15)16)8(17)14(4-2)6-9(10,11)12/h3-6H2,1-2H3,(H,15,16)
InChIKeyMAWHQKUENVDNHC-UHFFFAOYSA-N
MW256.22 g/mol
LogP1.40
Rot. Bonds5

About 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid

2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid (PubChem CID 55009948) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid.

Molecular Properties

Compound Name2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid
PubChem CID55009948
Molecular FormulaC9H15F3N2O3
Molecular Weight256.22 g/mol
Exact Mass256.10
IUPAC Name2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid
SMILESCCN(CC(=O)O)C(=O)N(CC)CC(F)(F)F
InChIInChI=1S/C9H15F3N2O3/c1-3-13(5-7(15)16)8(17)14(4-2)6-9(10,11)12/h3-6H2,1-2H3,(H,15,16)
InChIKeyMAWHQKUENVDNHC-UHFFFAOYSA-N
XLogP1.40
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.22
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid?
The IUPAC name of 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid (CID 55009948) is 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid.
What is the SMILES notation for 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid?
The canonical SMILES for 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid is CCN(CC(=O)O)C(=O)N(CC)CC(F)(F)F.
What is the InChIKey of 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid?
The InChIKey is MAWHQKUENVDNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c1-3-13(5-7(15)16)8(17)14(4-2)6-9(10,11)12/h3-6H2,1-2H3,(H,15,16).
What are the key properties of 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid?
2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid has a molecular weight of 256.22 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl-[ethyl(2,2,2-trifluoroethyl)carbamoyl]amino]acetic acid is sourced from PubChem (CID 55009948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).