C30H50O — CID 550102
2,6,10,15,19,23-hexamethyltetracosa-1,6,10,14,18,22-hexaen-3-ol (PubChem CID 550102) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-1,6,10,14,18,22-hexaen-3-ol.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-1,6,10,14,18,22-hexaen-3-ol |
|---|---|
| PubChem CID | 550102 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-1,6,10,14,18,22-hexaen-3-ol |
| SMILES | C=C(C)C(O)CCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C30H50O/c1-24(2)14-11-17-28(7)20-12-18-26(5)15-9-10-16-27(6)19-13-21-29(8)22-23-30(31)25(3)4/h14-16,20-21,30-31H,3,9-13,17-19,22-23H2,1-2,4-8H3 |
| InChIKey | JLUBMMAQMKVTGL-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|