C11H16F3N3O — CID 55010238
1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde (PubChem CID 55010238) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 55010238 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(N(CC(F)(F)F)C(C)C)c1C=O |
| InChI | InChI=1S/C11H16F3N3O/c1-7(2)17(6-11(12,13)14)10-9(5-18)8(3)15-16(10)4/h5,7H,6H2,1-4H3 |
| InChIKey | ONNXAEAILAJBHA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|