C12H13F3N2O2 — CID 55010486
6-[ethyl(2,2,2-trifluoroethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 55010486) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 6-[ethyl(2,2,2-trifluoroethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6-[ethyl(2,2,2-trifluoroethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 55010486 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 6-[ethyl(2,2,2-trifluoroethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCN(CC(F)(F)F)c1ccc2c(c1)NC(=O)C2O |
| InChI | InChI=1S/C12H13F3N2O2/c1-2-17(6-12(13,14)15)7-3-4-8-9(5-7)16-11(19)10(8)18/h3-5,10,18H,2,6H2,1H3,(H,16,19) |
| InChIKey | FVHZRYNFNYZGPZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|