C10H20F3N3O2S — CID 55010625
N-propyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide (PubChem CID 55010625) has the molecular formula C10H20F3N3O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is N-propyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide.
| Compound Name | N-propyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 55010625 |
| Molecular Formula | C10H20F3N3O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-propyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C10H20F3N3O2S/c1-2-6-16(9-10(11,12)13)19(17,18)15-7-3-4-14-5-8-15/h14H,2-9H2,1H3 |
| InChIKey | XCCRPAMVWYCRTI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |