C11H14F3N3O — CID 55010765
5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carbaldehyde (PubChem CID 55010765) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carbaldehyde.
| Compound Name | 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 55010765 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(N(CC(F)(F)F)C2CC2)c1C=O |
| InChI | InChI=1S/C11H14F3N3O/c1-7-9(5-18)10(16(2)15-7)17(8-3-4-8)6-11(12,13)14/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | DSCFBPGDRXNDQV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|