C11H13F4N3 — CID 55011485
4-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarboximidamide (PubChem CID 55011485) has the molecular formula C11H13F4N3 and a molecular weight of 263.24 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarboximidamide.
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 55011485 |
| Molecular Formula | C11H13F4N3 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(CC)CC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H13F4N3/c1-2-18(6-11(13,14)15)9-4-3-7(10(16)17)5-8(9)12/h3-5H,2,6H2,1H3,(H3,16,17) |
| InChIKey | RXYPAGCDJKQURR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|