About 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid
5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 55011664) has the molecular formula C9H10F3NO4S2
and a molecular weight of 317.31 g/mol. Its IUPAC name is 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid |
| PubChem CID | 55011664 |
| Molecular Formula | C9H10F3NO4S2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CCN(CC(F)(F)F)S(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C9H10F3NO4S2/c1-2-13(5-9(10,11)12)19(16,17)7-4-3-6(18-7)8(14)15/h3-4H,2,5H2,1H3,(H,14,15) |
| InChIKey | PRJZWTPCRDGDSH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid (CID 55011664) is 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid is CCN(CC(F)(F)F)S(=O)(=O)c1ccc(C(=O)O)s1.
What is the InChIKey of 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid?
The InChIKey is PRJZWTPCRDGDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO4S2/c1-2-13(5-9(10,11)12)19(16,17)7-4-3-6(18-7)8(14)15/h3-4H,2,5H2,1H3,(H,14,15).
What are the key properties of 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid?
5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid has a molecular weight of 317.31 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 55011664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).