C13H16N2O3 — CID 55011767
4-[[6-(methylaminomethyl)-1,3-benzodioxol-5-yl]oxy]butanenitrile (PubChem CID 55011767) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-[[6-(methylaminomethyl)-1,3-benzodioxol-5-yl]oxy]butanenitrile.
| Compound Name | 4-[[6-(methylaminomethyl)-1,3-benzodioxol-5-yl]oxy]butanenitrile |
|---|---|
| PubChem CID | 55011767 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-[[6-(methylaminomethyl)-1,3-benzodioxol-5-yl]oxy]butanenitrile |
| SMILES | CNCc1cc2c(cc1OCCCC#N)OCO2 |
| InChI | InChI=1S/C13H16N2O3/c1-15-8-10-6-12-13(18-9-17-12)7-11(10)16-5-3-2-4-14/h6-7,15H,2-3,5,8-9H2,1H3 |
| InChIKey | ISKSUJAEOUAKJD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|