C13H22N4 — CID 55011902
4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-1H-imidazol-5-amine (PubChem CID 55011902) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-1H-imidazol-5-amine.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-1H-imidazol-5-amine |
|---|---|
| PubChem CID | 55011902 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-1H-imidazol-5-amine |
| SMILES | Cc1nc(N2CCC3CCCCC3C2)c(N)[nH]1 |
| InChI | InChI=1S/C13H22N4/c1-9-15-12(14)13(16-9)17-7-6-10-4-2-3-5-11(10)8-17/h10-11H,2-8,14H2,1H3,(H,15,16) |
| InChIKey | QDHVRFFFPAMLIQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |