C13H13NO3S — CID 55012009
[6-(thiophen-3-ylmethoxy)-1,3-benzodioxol-5-yl]methanamine (PubChem CID 55012009) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is [6-(thiophen-3-ylmethoxy)-1,3-benzodioxol-5-yl]methanamine.
| Compound Name | [6-(thiophen-3-ylmethoxy)-1,3-benzodioxol-5-yl]methanamine |
|---|---|
| PubChem CID | 55012009 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [6-(thiophen-3-ylmethoxy)-1,3-benzodioxol-5-yl]methanamine |
| SMILES | NCc1cc2c(cc1OCc1ccsc1)OCO2 |
| InChI | InChI=1S/C13H13NO3S/c14-5-10-3-12-13(17-8-16-12)4-11(10)15-6-9-1-2-18-7-9/h1-4,7H,5-6,8,14H2 |
| InChIKey | RDONUCKACMDWFB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |