About 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide
7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide (PubChem CID 55012408) has the molecular formula C12H21N3OS
and a molecular weight of 255.39 g/mol. Its IUPAC name is 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide.
Molecular Properties
| Compound Name | 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide |
| PubChem CID | 55012408 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide |
| SMILES | CN(Cc1cscn1)C(=O)CCCCCCN |
| InChI | InChI=1S/C12H21N3OS/c1-15(8-11-9-17-10-14-11)12(16)6-4-2-3-5-7-13/h9-10H,2-8,13H2,1H3 |
| InChIKey | CZYMAGLLISEEJK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide?
The IUPAC name of 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide (CID 55012408) is 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide.
What is the SMILES notation for 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide?
The canonical SMILES for 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide is CN(Cc1cscn1)C(=O)CCCCCCN.
What is the InChIKey of 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide?
The InChIKey is CZYMAGLLISEEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3OS/c1-15(8-11-9-17-10-14-11)12(16)6-4-2-3-5-7-13/h9-10H,2-8,13H2,1H3.
What are the key properties of 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide?
7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide has a molecular weight of 255.39 g/mol, XLogP of 2.01, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)heptanamide is sourced from PubChem (CID 55012408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).